Boronic acid derivatives
Aobchem 3-Bromo-2-methoxyphenylboronic acid pinacol ester | 97% | CAS 2096997-23-6 | C13H18BBrO3 | 1g
3-Bromo-2-methoxyphenylboronic acid pinacol ester | 97% | CAS 2096997-23-6 | C13H18BBrO3 | 1g
Aobchem 3-Bromo-2-methoxyphenylboronic acid pinacol ester | 97% | CAS 2096997-23-6 | C13H18BBrO3 | 500mg
3-Bromo-2-methoxyphenylboronic acid pinacol ester | 97% | CAS 2096997-23-6 | C13H18BBrO3 | 500mg
eMolecules 14047-29-1 | 4-Carboxyphenylboronic acid | Key Organics/BIONET | MFCD00151801 | 165.940 | C7H7BO4 | 90.000 | OB(O)c1ccc(cc1)C(O)=O | 500mg | 564101496
4-Carboxyphenylboronic acid | Key Organics/BIONET | 14047-29-1 | MFCD00151801 | 165.940 | C7H7BO4 | 90.000 | OB(O)c1ccc(cc1)C(O)=O | 500mg | 564101496
eMolecules 120728-10-1 | 1-((tert-Butoxycarbonyl)amino)cyclobutanecarboxylic acid | AbaChemScene | MFCD02682623 | 215.249 | C10H17NO4 | 97.000 | CC(C)(C)OC(=O)NC1(CCC1)C(O)=O | 10g | 391084973
1-((tert-Butoxycarbonyl)amino)cyclobutanecarboxylic acid | AbaChemScene | 120728-10-1 | MFCD02682623 | 215.249 | C10H17NO4 | 97.000 | CC(C)(C)OC(=O)NC1(CCC1)C(O)=O | 10g | 391084973
Aobchem 2-Cyano-6-methoxyphenylboronic acid | ≥97% | CAS 1164100-85-9 | C8H8BNO3 | 500mg
2-Cyano-6-methoxyphenylboronic acid | ≥97% | CAS 1164100-85-9 | C8H8BNO3 | 500mg
Aobchem 4 5-Dimethyl-3-fluorophenylboronic acid pinacol ester | 97% | C14H20BFO2 | 500mg
4 5-Dimethyl-3-fluorophenylboronic acid pinacol ester | 97% | C14H20BFO2 | 500mg
Aobchem Furan-3-boronic acid | 97% | CAS 55552-70-0 | C4H5BO3 | 100g
Furan-3-boronic acid | 97% | CAS 55552-70-0 | C4H5BO3 | 100g
Aobchem 3-Chloro-2-fluorophenylboronic acid | ≥97% | CAS 352535-82-1 | C6H5BClFO2 | 100g
3-Chloro-2-fluorophenylboronic acid | ≥97% | CAS 352535-82-1 | C6H5BClFO2 | 100g
Medchemexpress LLC (S)-Butoxycarbonylamino-cyclopropyl-acetic acid | 155976-13-9 | 98.0% | C10H17NO4 | 10 G
(S)-Butoxycarbonylamino-cyclopropyl-acetic acid is a Glycine derivative. It is for research use only and not sold to patients. Amino acids and amino acid derivatives, such as this compound, are commercially used as ergogenic supplements. They can influence the secretion of anabolic hormones, supply fuel during exercise, improve mental performance under stress, and prevent exercise-induced muscle damage.
- Molecular weight: 215.25
- Formula: C10H17NO4
- CAS No.: 155976-13-9
- Appearance: Solid
- Color: White to off-white
- Purity: 98.0%
- Shipping: Room temperature in continental US
- Storage (powder): -20°C for 3 years, 4°C for 2 years
- Storage (in solvent): -80°C for 6 months, -20°C for 1 month
- Solubility (in vitro) in DMSO: 100 mg/mL (464.58 mM)
eMolecules 214360-73-3 | 4-Aminophenylboronic acid pinacol ester | ChemScene | MFCD02093721 | 219.090 | C12H18BNO2 | 98.000 | CC1(C)OB(OC1(C)C)c1ccc(N)cc1 | 5g | 266546094
4-Aminophenylboronic acid pinacol ester | ChemScene | 214360-73-3 | MFCD02093721 | 219.090 | C12H18BNO2 | 98.000 | CC1(C)OB(OC1(C)C)c1ccc(N)cc1 | 5g | 266546094
eMolecules 214360-73-3 | 4-Aminophenylboronic acid pinacol ester | ChemScene | MFCD02093721 | 219.090 | C12H18BNO2 | 98.000 | CC1(C)OB(OC1(C)C)c1ccc(N)cc1 | 25g | 536836842
4-Aminophenylboronic acid pinacol ester | ChemScene | 214360-73-3 | MFCD02093721 | 219.090 | C12H18BNO2 | 98.000 | CC1(C)OB(OC1(C)C)c1ccc(N)cc1 | 25g | 536836842
Medchemexpress LLC Ethylboronic acid | 4433-63-0 | 73.89 | 5 G
Ethylboronic acid is an organic boron compound that serves as a drug intermediate for constructing macrocycles, capsules, polymers, and covalent organic frameworks (COFs). This product is for research use only.
- Organic boron compound
- Functions as a drug intermediate
- Used to construct macrocycles, capsules, polymers, and covalent organic frameworks (COFs)
- Soluble in DMSO at 200 mg/mL
eMolecules 214360-73-3 | 4-Aminobenzeneboronic acid, pinacol ester | Apollo Scientific | MFCD02093721 | 219.090 | C12H18BNO2 | 95.000 | CC1(C)OB(OC1(C)C)c1ccc(N)cc1 | 5g | 600854812
4-Aminobenzeneboronic acid, pinacol ester | Apollo Scientific | 214360-73-3 | MFCD02093721 | 219.090 | C12H18BNO2 | 95.000 | CC1(C)OB(OC1(C)C)c1ccc(N)cc1 | 5g | 600854812